About ethane;1-ethyl-4-(oxetan-3-yl)piperazine;4-ethylpiperidin-4-ol
ethane;1-ethyl-4-(oxetan-3-yl)piperazine;4-ethylpiperidin-4-ol (PubChem CID 178029584) has the molecular formula C20H45N3O2
and a molecular weight of 359.60 g/mol. Its IUPAC name is ethane;1-ethyl-4-(oxetan-3-yl)piperazine;4-ethylpiperidin-4-ol.
Molecular Properties
| Compound Name | ethane;1-ethyl-4-(oxetan-3-yl)piperazine;4-ethylpiperidin-4-ol |
| PubChem CID | 178029584 |
| Molecular Formula | C20H45N3O2 |
| Molecular Weight | 359.60 g/mol |
| Exact Mass | 359.35 |
| IUPAC Name | ethane;1-ethyl-4-(oxetan-3-yl)piperazine;4-ethylpiperidin-4-ol |
| SMILES | CC.CC.CCC1(O)CCNCC1.CCN1CCN(C2COC2)CC1 |
| InChI | InChI=1S/C9H18N2O.C7H15NO.2C2H6/c1-2-10-3-5-11(6-4-10)9-7-12-8-9;1-2-7(9)3-5-8-6-4-7;2*1-2/h9H,2-8H2,1H3;8-9H,2-6H2,1H3;2*1-2H3 |
| InChIKey | QKKRMLMDTGYXBB-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 47.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.60 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethane;1-ethyl-4-(oxetan-3-yl)piperazine;4-ethylpiperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethyl-4-(oxetan-3-yl)piperazine;4-ethylpiperidin-4-ol?
The IUPAC name of ethane;1-ethyl-4-(oxetan-3-yl)piperazine;4-ethylpiperidin-4-ol (CID 178029584) is ethane;1-ethyl-4-(oxetan-3-yl)piperazine;4-ethylpiperidin-4-ol.
What is the SMILES notation for ethane;1-ethyl-4-(oxetan-3-yl)piperazine;4-ethylpiperidin-4-ol?
The canonical SMILES for ethane;1-ethyl-4-(oxetan-3-yl)piperazine;4-ethylpiperidin-4-ol is CC.CC.CCC1(O)CCNCC1.CCN1CCN(C2COC2)CC1.
What is the InChIKey of ethane;1-ethyl-4-(oxetan-3-yl)piperazine;4-ethylpiperidin-4-ol?
The InChIKey is QKKRMLMDTGYXBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O.C7H15NO.2C2H6/c1-2-10-3-5-11(6-4-10)9-7-12-8-9;1-2-7(9)3-5-8-6-4-7;2*1-2/h9H,2-8H2,1H3;8-9H,2-6H2,1H3;2*1-2H3.
What are the key properties of ethane;1-ethyl-4-(oxetan-3-yl)piperazine;4-ethylpiperidin-4-ol?
ethane;1-ethyl-4-(oxetan-3-yl)piperazine;4-ethylpiperidin-4-ol has a molecular weight of 359.60 g/mol, XLogP of 2.59, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethyl-4-(oxetan-3-yl)piperazine;4-ethylpiperidin-4-ol is sourced from PubChem (CID 178029584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).