C8H16N2O — CID 59534690
7-ethyl-1,3,5,6,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyrazine (PubChem CID 59534690) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is 7-ethyl-1,3,5,6,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyrazine.
| Compound Name | 7-ethyl-1,3,5,6,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyrazine |
|---|---|
| PubChem CID | 59534690 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 7-ethyl-1,3,5,6,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyrazine |
| SMILES | CCN1CCN2COCC2C1 |
| InChI | InChI=1S/C8H16N2O/c1-2-9-3-4-10-7-11-6-8(10)5-9/h8H,2-7H2,1H3 |
| InChIKey | YIJQTZZMZXOISZ-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |