C11H21FN2O — CID 129349201
(9aR)-8-[(3S)-3-fluorobutyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine (PubChem CID 129349201) has the molecular formula C11H21FN2O and a molecular weight of 216.30 g/mol. Its IUPAC name is (9aR)-8-[(3S)-3-fluorobutyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine.
| Compound Name | (9aR)-8-[(3S)-3-fluorobutyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 129349201 |
| Molecular Formula | C11H21FN2O |
| Molecular Weight | 216.30 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | (9aR)-8-[(3S)-3-fluorobutyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine |
| SMILES | C[C@H](F)CCN1CCN2CCOC[C@H]2C1 |
| InChI | InChI=1S/C11H21FN2O/c1-10(12)2-3-13-4-5-14-6-7-15-9-11(14)8-13/h10-11H,2-9H2,1H3/t10-,11+/m0/s1 |
| InChIKey | DEEBNPZKCYTBGK-WDEREUQCSA-N |
| XLogP | 0.75 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.30 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |