C14H11N5O2 — CID 178030263
N-[6-(6-amino-3-pyridinyl)pyridazin-3-yl]furan-3-carboxamide (PubChem CID 178030263) has the molecular formula C14H11N5O2 and a molecular weight of 281.28 g/mol. Its IUPAC name is N-[6-(6-amino-3-pyridinyl)pyridazin-3-yl]furan-3-carboxamide.
| Compound Name | N-[6-(6-amino-3-pyridinyl)pyridazin-3-yl]furan-3-carboxamide |
|---|---|
| PubChem CID | 178030263 |
| Molecular Formula | C14H11N5O2 |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | N-[6-(6-amino-3-pyridinyl)pyridazin-3-yl]furan-3-carboxamide |
| SMILES | Nc1ccc(-c2ccc(NC(=O)c3ccoc3)nn2)cn1 |
| InChI | InChI=1S/C14H11N5O2/c15-12-3-1-9(7-16-12)11-2-4-13(19-18-11)17-14(20)10-5-6-21-8-10/h1-8H,(H2,15,16)(H,17,19,20) |
| InChIKey | LFELGKXKQKXSPX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 106.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |