C16H10F3N3O2 — CID 178030091
N-[6-[2-(trifluoromethyl)phenyl]pyridazin-3-yl]furan-3-carboxamide (PubChem CID 178030091) has the molecular formula C16H10F3N3O2 and a molecular weight of 333.27 g/mol. Its IUPAC name is N-[6-[2-(trifluoromethyl)phenyl]pyridazin-3-yl]furan-3-carboxamide.
| Compound Name | N-[6-[2-(trifluoromethyl)phenyl]pyridazin-3-yl]furan-3-carboxamide |
|---|---|
| PubChem CID | 178030091 |
| Molecular Formula | C16H10F3N3O2 |
| Molecular Weight | 333.27 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | N-[6-[2-(trifluoromethyl)phenyl]pyridazin-3-yl]furan-3-carboxamide |
| SMILES | O=C(Nc1ccc(-c2ccccc2C(F)(F)F)nn1)c1ccoc1 |
| InChI | InChI=1S/C16H10F3N3O2/c17-16(18,19)12-4-2-1-3-11(12)13-5-6-14(22-21-13)20-15(23)10-7-8-24-9-10/h1-9H,(H,20,22,23) |
| InChIKey | QZRKREXXMMVBSQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.27 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |