About N-[5-(dihydroxyamino)-1,3-thiazol-2-yl]furan-3-carboxamide
N-[5-(dihydroxyamino)-1,3-thiazol-2-yl]furan-3-carboxamide (PubChem CID 88587269) has the molecular formula C8H7N3O4S
and a molecular weight of 241.23 g/mol. Its IUPAC name is N-[5-(dihydroxyamino)-1,3-thiazol-2-yl]furan-3-carboxamide.
Molecular Properties
| Compound Name | N-[5-(dihydroxyamino)-1,3-thiazol-2-yl]furan-3-carboxamide |
| PubChem CID | 88587269 |
| Molecular Formula | C8H7N3O4S |
| Molecular Weight | 241.23 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | N-[5-(dihydroxyamino)-1,3-thiazol-2-yl]furan-3-carboxamide |
| SMILES | O=C(Nc1ncc(N(O)O)s1)c1ccoc1 |
| InChI | InChI=1S/C8H7N3O4S/c12-7(5-1-2-15-4-5)10-8-9-3-6(16-8)11(13)14/h1-4,13-14H,(H,9,10,12) |
| InChIKey | JSUNMJQOYQXJQH-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.23 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[5-(dihydroxyamino)-1,3-thiazol-2-yl]furan-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(dihydroxyamino)-1,3-thiazol-2-yl]furan-3-carboxamide?
The IUPAC name of N-[5-(dihydroxyamino)-1,3-thiazol-2-yl]furan-3-carboxamide (CID 88587269) is N-[5-(dihydroxyamino)-1,3-thiazol-2-yl]furan-3-carboxamide.
What is the SMILES notation for N-[5-(dihydroxyamino)-1,3-thiazol-2-yl]furan-3-carboxamide?
The canonical SMILES for N-[5-(dihydroxyamino)-1,3-thiazol-2-yl]furan-3-carboxamide is O=C(Nc1ncc(N(O)O)s1)c1ccoc1.
What is the InChIKey of N-[5-(dihydroxyamino)-1,3-thiazol-2-yl]furan-3-carboxamide?
The InChIKey is JSUNMJQOYQXJQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O4S/c12-7(5-1-2-15-4-5)10-8-9-3-6(16-8)11(13)14/h1-4,13-14H,(H,9,10,12).
What are the key properties of N-[5-(dihydroxyamino)-1,3-thiazol-2-yl]furan-3-carboxamide?
N-[5-(dihydroxyamino)-1,3-thiazol-2-yl]furan-3-carboxamide has a molecular weight of 241.23 g/mol, XLogP of 1.57, 3 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(dihydroxyamino)-1,3-thiazol-2-yl]furan-3-carboxamide is sourced from PubChem (CID 88587269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).