C8H7N3O4S — CID 88587269
N-[5-(dihydroxyamino)-1,3-thiazol-2-yl]furan-3-carboxamide (PubChem CID 88587269) has the molecular formula C8H7N3O4S and a molecular weight of 241.23 g/mol. Its IUPAC name is N-[5-(dihydroxyamino)-1,3-thiazol-2-yl]furan-3-carboxamide.
| Compound Name | N-[5-(dihydroxyamino)-1,3-thiazol-2-yl]furan-3-carboxamide |
|---|---|
| PubChem CID | 88587269 |
| Molecular Formula | C8H7N3O4S |
| Molecular Weight | 241.23 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | N-[5-(dihydroxyamino)-1,3-thiazol-2-yl]furan-3-carboxamide |
| SMILES | O=C(Nc1ncc(N(O)O)s1)c1ccoc1 |
| InChI | InChI=1S/C8H7N3O4S/c12-7(5-1-2-15-4-5)10-8-9-3-6(16-8)11(13)14/h1-4,13-14H,(H,9,10,12) |
| InChIKey | JSUNMJQOYQXJQH-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.23 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|