C30H29ClF3N3O7 — CID 178030588
3-[1-[3-[[1-(4-chloro-2-methoxyphenyl)-2-oxo-2-[6-(trifluoromethoxy)-2,3-dihydroindol-1-yl]ethyl]amino]-5-methoxyphenyl]ethylideneamino]oxypropanoic acid (PubChem CID 178030588) has the molecular formula C30H29ClF3N3O7 and a molecular weight of 636.02 g/mol. Its IUPAC name is 3-[1-[3-[[1-(4-chloro-2-methoxyphenyl)-2-oxo-2-[6-(trifluoromethoxy)-2,3-dihydroindol-1-yl]ethyl]amino]-5-methoxyphenyl]ethylideneamino]oxypropanoic acid.
| Compound Name | 3-[1-[3-[[1-(4-chloro-2-methoxyphenyl)-2-oxo-2-[6-(trifluoromethoxy)-2,3-dihydroindol-1-yl]ethyl]amino]-5-methoxyphenyl]ethylideneamino]oxypropanoic acid |
|---|---|
| PubChem CID | 178030588 |
| Molecular Formula | C30H29ClF3N3O7 |
| Molecular Weight | 636.02 g/mol |
| Exact Mass | 635.16 |
| IUPAC Name | 3-[1-[3-[[1-(4-chloro-2-methoxyphenyl)-2-oxo-2-[6-(trifluoromethoxy)-2,3-dihydroindol-1-yl]ethyl]amino]-5-methoxyphenyl]ethylideneamino]oxypropanoic acid |
| SMILES | COc1cc(NC(C(=O)N2CCc3ccc(OC(F)(F)F)cc32)c2ccc(Cl)cc2OC)cc(C(C)=NOCCC(=O)O)c1 |
| InChI | InChI=1S/C30H29ClF3N3O7/c1-17(36-43-11-9-27(38)39)19-12-21(15-23(13-19)41-2)35-28(24-7-5-20(31)14-26(24)42-3)29(40)37-10-8-18-4-6-22(16-25(18)37)44-30(32,33)34/h4-7,12-16,28,35H,8-11H2,1-3H3,(H,38,39) |
| InChIKey | QMNOUPKKICHLIS-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 118.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.02 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|