C29H26ClF3N4O5 — CID 178030651
2-[1-[3-[[1-(4-chloro-2-methoxyphenyl)-2-oxo-2-[6-(trifluoromethoxy)-2,3-dihydroindol-1-yl]ethyl]amino]-5-methoxyphenyl]ethylideneamino]oxyacetonitrile (PubChem CID 178030651) has the molecular formula C29H26ClF3N4O5 and a molecular weight of 603.00 g/mol. Its IUPAC name is 2-[1-[3-[[1-(4-chloro-2-methoxyphenyl)-2-oxo-2-[6-(trifluoromethoxy)-2,3-dihydroindol-1-yl]ethyl]amino]-5-methoxyphenyl]ethylideneamino]oxyacetonitrile.
| Compound Name | 2-[1-[3-[[1-(4-chloro-2-methoxyphenyl)-2-oxo-2-[6-(trifluoromethoxy)-2,3-dihydroindol-1-yl]ethyl]amino]-5-methoxyphenyl]ethylideneamino]oxyacetonitrile |
|---|---|
| PubChem CID | 178030651 |
| Molecular Formula | C29H26ClF3N4O5 |
| Molecular Weight | 603.00 g/mol |
| Exact Mass | 602.15 |
| IUPAC Name | 2-[1-[3-[[1-(4-chloro-2-methoxyphenyl)-2-oxo-2-[6-(trifluoromethoxy)-2,3-dihydroindol-1-yl]ethyl]amino]-5-methoxyphenyl]ethylideneamino]oxyacetonitrile |
| SMILES | COc1cc(NC(C(=O)N2CCc3ccc(OC(F)(F)F)cc32)c2ccc(Cl)cc2OC)cc(C(C)=NOCC#N)c1 |
| InChI | InChI=1S/C29H26ClF3N4O5/c1-17(36-41-11-9-34)19-12-21(15-23(13-19)39-2)35-27(24-7-5-20(30)14-26(24)40-3)28(38)37-10-8-18-4-6-22(16-25(18)37)42-29(31,32)33/h4-7,12-16,27,35H,8,10-11H2,1-3H3 |
| InChIKey | SHNZELKDFQRNLG-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 105.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.00 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|