C32H33ClF3N3O7 — CID 178030640
3-[1-[3-[[1-(4-chloro-2-methoxyphenyl)-2-[3,3-dimethyl-6-(trifluoromethoxy)-2H-indol-1-yl]-2-oxoethyl]amino]-5-methoxyphenyl]ethylideneamino]oxypropanoic acid (PubChem CID 178030640) has the molecular formula C32H33ClF3N3O7 and a molecular weight of 664.08 g/mol. Its IUPAC name is 3-[1-[3-[[1-(4-chloro-2-methoxyphenyl)-2-[3,3-dimethyl-6-(trifluoromethoxy)-2H-indol-1-yl]-2-oxoethyl]amino]-5-methoxyphenyl]ethylideneamino]oxypropanoic acid.
| Compound Name | 3-[1-[3-[[1-(4-chloro-2-methoxyphenyl)-2-[3,3-dimethyl-6-(trifluoromethoxy)-2H-indol-1-yl]-2-oxoethyl]amino]-5-methoxyphenyl]ethylideneamino]oxypropanoic acid |
|---|---|
| PubChem CID | 178030640 |
| Molecular Formula | C32H33ClF3N3O7 |
| Molecular Weight | 664.08 g/mol |
| Exact Mass | 663.20 |
| IUPAC Name | 3-[1-[3-[[1-(4-chloro-2-methoxyphenyl)-2-[3,3-dimethyl-6-(trifluoromethoxy)-2H-indol-1-yl]-2-oxoethyl]amino]-5-methoxyphenyl]ethylideneamino]oxypropanoic acid |
| SMILES | COc1cc(NC(C(=O)N2CC(C)(C)c3ccc(OC(F)(F)F)cc32)c2ccc(Cl)cc2OC)cc(C(C)=NOCCC(=O)O)c1 |
| InChI | InChI=1S/C32H33ClF3N3O7/c1-18(38-45-11-10-28(40)41)19-12-21(15-23(13-19)43-4)37-29(24-8-6-20(33)14-27(24)44-5)30(42)39-17-31(2,3)25-9-7-22(16-26(25)39)46-32(34,35)36/h6-9,12-16,29,37H,10-11,17H2,1-5H3,(H,40,41) |
| InChIKey | MCPPRKNDVAYLPU-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 118.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.08 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|