C10H17FN2O — CID 178034055
3-fluoro-8-prop-1-en-2-yl-1-oxa-3,8-diazaspiro[4.5]decane (PubChem CID 178034055) has the molecular formula C10H17FN2O and a molecular weight of 200.26 g/mol. Its IUPAC name is 3-fluoro-8-prop-1-en-2-yl-1-oxa-3,8-diazaspiro[4.5]decane.
| Compound Name | 3-fluoro-8-prop-1-en-2-yl-1-oxa-3,8-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 178034055 |
| Molecular Formula | C10H17FN2O |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 3-fluoro-8-prop-1-en-2-yl-1-oxa-3,8-diazaspiro[4.5]decane |
| SMILES | C=C(C)N1CCC2(CC1)CN(F)CO2 |
| InChI | InChI=1S/C10H17FN2O/c1-9(2)12-5-3-10(4-6-12)7-13(11)8-14-10/h1,3-8H2,2H3 |
| InChIKey | VVNHYFVIACLPKS-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|