C22H19ClFN5O4 — CID 178034871
4-[5-chloro-2-[3-fluoro-4-(morpholine-4-carbonyl)anilino]pyrimidin-4-yl]-N-hydroxybenzamide (PubChem CID 178034871) has the molecular formula C22H19ClFN5O4 and a molecular weight of 471.88 g/mol. Its IUPAC name is 4-[5-chloro-2-[3-fluoro-4-(morpholine-4-carbonyl)anilino]pyrimidin-4-yl]-N-hydroxybenzamide.
| Compound Name | 4-[5-chloro-2-[3-fluoro-4-(morpholine-4-carbonyl)anilino]pyrimidin-4-yl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 178034871 |
| Molecular Formula | C22H19ClFN5O4 |
| Molecular Weight | 471.88 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | 4-[5-chloro-2-[3-fluoro-4-(morpholine-4-carbonyl)anilino]pyrimidin-4-yl]-N-hydroxybenzamide |
| SMILES | O=C(NO)c1ccc(-c2nc(Nc3ccc(C(=O)N4CCOCC4)c(F)c3)ncc2Cl)cc1 |
| InChI | InChI=1S/C22H19ClFN5O4/c23-17-12-25-22(27-19(17)13-1-3-14(4-2-13)20(30)28-32)26-15-5-6-16(18(24)11-15)21(31)29-7-9-33-10-8-29/h1-6,11-12,32H,7-10H2,(H,28,30)(H,25,26,27) |
| InChIKey | RPYSWESEDFXMDO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 116.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.88 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|