C27H32FN3O5 — CID 178037456
N-cyclopropylformamide;N-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2-fluorophenyl]formamide;1,1-dimethylcyclopropane (PubChem CID 178037456) has the molecular formula C27H32FN3O5 and a molecular weight of 497.57 g/mol. Its IUPAC name is N-cyclopropylformamide;N-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2-fluorophenyl]formamide;1,1-dimethylcyclopropane.
| Compound Name | N-cyclopropylformamide;N-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2-fluorophenyl]formamide;1,1-dimethylcyclopropane |
|---|---|
| PubChem CID | 178037456 |
| Molecular Formula | C27H32FN3O5 |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | N-cyclopropylformamide;N-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2-fluorophenyl]formamide;1,1-dimethylcyclopropane |
| SMILES | CC1(C)CC1.COc1cc2nccc(Oc3ccc(NC=O)c(F)c3)c2cc1OC.O=CNC1CC1 |
| InChI | InChI=1S/C18H15FN2O4.C5H10.C4H7NO/c1-23-17-8-12-15(9-18(17)24-2)20-6-5-16(12)25-11-3-4-14(21-10-22)13(19)7-11;1-5(2)3-4-5;6-3-5-4-1-2-4/h3-10H,1-2H3,(H,21,22);3-4H2,1-2H3;3-4H,1-2H2,(H,5,6) |
| InChIKey | SNIAOSSQZAQMJK-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|