C22H23FN2O6S — CID 143878405
(E)-N-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2-fluorophenyl]-1-methoxybut-1-ene-1-sulfonamide (PubChem CID 143878405) has the molecular formula C22H23FN2O6S and a molecular weight of 462.50 g/mol. Its IUPAC name is (E)-N-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2-fluorophenyl]-1-methoxybut-1-ene-1-sulfonamide.
| Compound Name | (E)-N-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2-fluorophenyl]-1-methoxybut-1-ene-1-sulfonamide |
|---|---|
| PubChem CID | 143878405 |
| Molecular Formula | C22H23FN2O6S |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | (E)-N-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2-fluorophenyl]-1-methoxybut-1-ene-1-sulfonamide |
| SMILES | CC/C=C(\OC)S(=O)(=O)Nc1ccc(Oc2ccnc3cc(OC)c(OC)cc23)cc1F |
| InChI | InChI=1S/C22H23FN2O6S/c1-5-6-22(30-4)32(26,27)25-17-8-7-14(11-16(17)23)31-19-9-10-24-18-13-21(29-3)20(28-2)12-15(18)19/h6-13,25H,5H2,1-4H3/b22-6+ |
| InChIKey | ZLVTTXZBMZCQEU-GEVRCRHISA-N |
| XLogP | 4.82 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|