About 3-[5-(2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-7-yl)pyrimidin-2-yl]heptan-3-ol
3-[5-(2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-7-yl)pyrimidin-2-yl]heptan-3-ol (PubChem CID 178039165) has the molecular formula C21H26N4O
and a molecular weight of 350.47 g/mol. Its IUPAC name is 3-[5-(2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-7-yl)pyrimidin-2-yl]heptan-3-ol.
Molecular Properties
| Compound Name | 3-[5-(2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-7-yl)pyrimidin-2-yl]heptan-3-ol |
| PubChem CID | 178039165 |
| Molecular Formula | C21H26N4O |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 3-[5-(2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-7-yl)pyrimidin-2-yl]heptan-3-ol |
| SMILES | CCCCC(O)(CC)c1ncc(-c2ccc3nc4n(c3c2)CCC4)cn1 |
| InChI | InChI=1S/C21H26N4O/c1-3-5-10-21(26,4-2)20-22-13-16(14-23-20)15-8-9-17-18(12-15)25-11-6-7-19(25)24-17/h8-9,12-14,26H,3-7,10-11H2,1-2H3 |
| InChIKey | DMCXXCQXNCYRFV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[5-(2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-7-yl)pyrimidin-2-yl]heptan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-7-yl)pyrimidin-2-yl]heptan-3-ol?
The IUPAC name of 3-[5-(2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-7-yl)pyrimidin-2-yl]heptan-3-ol (CID 178039165) is 3-[5-(2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-7-yl)pyrimidin-2-yl]heptan-3-ol.
What is the SMILES notation for 3-[5-(2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-7-yl)pyrimidin-2-yl]heptan-3-ol?
The canonical SMILES for 3-[5-(2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-7-yl)pyrimidin-2-yl]heptan-3-ol is CCCCC(O)(CC)c1ncc(-c2ccc3nc4n(c3c2)CCC4)cn1.
What is the InChIKey of 3-[5-(2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-7-yl)pyrimidin-2-yl]heptan-3-ol?
The InChIKey is DMCXXCQXNCYRFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N4O/c1-3-5-10-21(26,4-2)20-22-13-16(14-23-20)15-8-9-17-18(12-15)25-11-6-7-19(25)24-17/h8-9,12-14,26H,3-7,10-11H2,1-2H3.
What are the key properties of 3-[5-(2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-7-yl)pyrimidin-2-yl]heptan-3-ol?
3-[5-(2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-7-yl)pyrimidin-2-yl]heptan-3-ol has a molecular weight of 350.47 g/mol, XLogP of 4.23, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-7-yl)pyrimidin-2-yl]heptan-3-ol is sourced from PubChem (CID 178039165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).