C15H17BrF2N4 — CID 178041094
[5-bromo-3-(4,4-difluoropiperidin-1-yl)-7-methylisoquinolin-1-yl]hydrazine (PubChem CID 178041094) has the molecular formula C15H17BrF2N4 and a molecular weight of 371.23 g/mol. Its IUPAC name is [5-bromo-3-(4,4-difluoropiperidin-1-yl)-7-methylisoquinolin-1-yl]hydrazine.
| Compound Name | [5-bromo-3-(4,4-difluoropiperidin-1-yl)-7-methylisoquinolin-1-yl]hydrazine |
|---|---|
| PubChem CID | 178041094 |
| Molecular Formula | C15H17BrF2N4 |
| Molecular Weight | 371.23 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | [5-bromo-3-(4,4-difluoropiperidin-1-yl)-7-methylisoquinolin-1-yl]hydrazine |
| SMILES | Cc1cc(Br)c2cc(N3CCC(F)(F)CC3)nc(NN)c2c1 |
| InChI | InChI=1S/C15H17BrF2N4/c1-9-6-11-10(12(16)7-9)8-13(20-14(11)21-19)22-4-2-15(17,18)3-5-22/h6-8H,2-5,19H2,1H3,(H,20,21) |
| InChIKey | XSRCDCCZUYWTPF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.23 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|