C27H31N5 — CID 178045282
(10R,20R)-10-methyl-20-(1H-pyrazol-5-ylamino)-1-azatetracyclo[16.4.1.02,8.011,17]tricosa-2(8),3,6,11(17),12,14-hexaene-6-carbonitrile (PubChem CID 178045282) has the molecular formula C27H31N5 and a molecular weight of 425.58 g/mol. Its IUPAC name is (10R,20R)-10-methyl-20-(1H-pyrazol-5-ylamino)-1-azatetracyclo[16.4.1.02,8.011,17]tricosa-2(8),3,6,11(17),12,14-hexaene-6-carbonitrile.
| Compound Name | (10R,20R)-10-methyl-20-(1H-pyrazol-5-ylamino)-1-azatetracyclo[16.4.1.02,8.011,17]tricosa-2(8),3,6,11(17),12,14-hexaene-6-carbonitrile |
|---|---|
| PubChem CID | 178045282 |
| Molecular Formula | C27H31N5 |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | (10R,20R)-10-methyl-20-(1H-pyrazol-5-ylamino)-1-azatetracyclo[16.4.1.02,8.011,17]tricosa-2(8),3,6,11(17),12,14-hexaene-6-carbonitrile |
| SMILES | C[C@@H]1CC2=C(C=CCC(C#N)=C2)N2CC[C@H](Nc3ccn[nH]3)CC(C2)C2=C1C=CC=CC2 |
| InChI | InChI=1S/C27H31N5/c1-19-14-21-15-20(17-28)6-5-9-26(21)32-13-11-23(30-27-10-12-29-31-27)16-22(18-32)25-8-4-2-3-7-24(19)25/h2-5,7,9-10,12,15,19,22-23H,6,8,11,13-14,16,18H2,1H3,(H2,29,30,31)/t19-,22?,23+/m1/s1 |
| InChIKey | TZBHJHAYMMEKDC-QREQTRJTSA-N |
| XLogP | 5.42 |
| TPSA | 67.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |