C22H31N3 — CID 177144127
N-[(3a-methyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]inden-8-yl)methyl]-1H-pyrazol-5-amine (PubChem CID 177144127) has the molecular formula C22H31N3 and a molecular weight of 337.51 g/mol. Its IUPAC name is N-[(3a-methyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]inden-8-yl)methyl]-1H-pyrazol-5-amine.
| Compound Name | N-[(3a-methyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]inden-8-yl)methyl]-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 177144127 |
| Molecular Formula | C22H31N3 |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.25 |
| IUPAC Name | N-[(3a-methyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]inden-8-yl)methyl]-1H-pyrazol-5-amine |
| SMILES | CC(C)C1=C2C3=CC=C(CNc4ccn[nH]4)CCC3CCC2(C)CC1 |
| InChI | InChI=1S/C22H31N3/c1-15(2)18-9-12-22(3)11-8-17-6-4-16(5-7-19(17)21(18)22)14-23-20-10-13-24-25-20/h5,7,10,13,15,17H,4,6,8-9,11-12,14H2,1-3H3,(H2,23,24,25) |
| InChIKey | LMIOCIPBDRCMMW-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |