C24H37N3O8 — CID 178048286
[4-(propan-2-ylamino)-3-[(2S,3R,4S,5S,6S)-3,4,5-trihydroxy-6-(piperazine-1-carbonyl)oxan-2-yl]oxyphenyl]methyl 2-methylpropanoate (PubChem CID 178048286) has the molecular formula C24H37N3O8 and a molecular weight of 495.57 g/mol. Its IUPAC name is [4-(propan-2-ylamino)-3-[(2S,3R,4S,5S,6S)-3,4,5-trihydroxy-6-(piperazine-1-carbonyl)oxan-2-yl]oxyphenyl]methyl 2-methylpropanoate.
| Compound Name | [4-(propan-2-ylamino)-3-[(2S,3R,4S,5S,6S)-3,4,5-trihydroxy-6-(piperazine-1-carbonyl)oxan-2-yl]oxyphenyl]methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 178048286 |
| Molecular Formula | C24H37N3O8 |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | [4-(propan-2-ylamino)-3-[(2S,3R,4S,5S,6S)-3,4,5-trihydroxy-6-(piperazine-1-carbonyl)oxan-2-yl]oxyphenyl]methyl 2-methylpropanoate |
| SMILES | CC(C)Nc1ccc(COC(=O)C(C)C)cc1O[C@@H]1O[C@H](C(=O)N2CCNCC2)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C24H37N3O8/c1-13(2)23(32)33-12-15-5-6-16(26-14(3)4)17(11-15)34-24-20(30)18(28)19(29)21(35-24)22(31)27-9-7-25-8-10-27/h5-6,11,13-14,18-21,24-26,28-30H,7-10,12H2,1-4H3/t18-,19-,20+,21-,24+/m0/s1 |
| InChIKey | OPIXDFSWGDGKAY-NABGWTBKSA-N |
| XLogP | -0.18 |
| TPSA | 149.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |