C35H55N7O4 — CID 178049594
(3S)-3-[3-hydrazinyl-5-(4-pentanoylpiperazin-1-yl)phenyl]-4-[(3R)-3-[2-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanal;methanol (PubChem CID 178049594) has the molecular formula C35H55N7O4 and a molecular weight of 637.87 g/mol. Its IUPAC name is (3S)-3-[3-hydrazinyl-5-(4-pentanoylpiperazin-1-yl)phenyl]-4-[(3R)-3-[2-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanal;methanol.
| Compound Name | (3S)-3-[3-hydrazinyl-5-(4-pentanoylpiperazin-1-yl)phenyl]-4-[(3R)-3-[2-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanal;methanol |
|---|---|
| PubChem CID | 178049594 |
| Molecular Formula | C35H55N7O4 |
| Molecular Weight | 637.87 g/mol |
| Exact Mass | 637.43 |
| IUPAC Name | (3S)-3-[3-hydrazinyl-5-(4-pentanoylpiperazin-1-yl)phenyl]-4-[(3R)-3-[2-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanal;methanol |
| SMILES | CCCCC(=O)N1CCN(c2cc(NN)cc([C@H](CC=O)CN3CC[C@@H](CCc4cc(OC)c5c(n4)NCCC5)C3)c2)CC1.CO |
| InChI | InChI=1S/C34H51N7O3.CH4O/c1-3-4-7-33(43)41-16-14-40(15-17-41)30-20-27(19-29(21-30)38-35)26(11-18-42)24-39-13-10-25(23-39)8-9-28-22-32(44-2)31-6-5-12-36-34(31)37-28;1-2/h18-22,25-26,38H,3-17,23-24,35H2,1-2H3,(H,36,37);2H,1H3/t25-,26-;/m1./s1 |
| InChIKey | DZUUNVYGXHYHHA-JUJAXGASSA-N |
| XLogP | 3.81 |
| TPSA | 136.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.87 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|