C26H49IN4O6 — CID 178050058
N-butyl-3-[2-[[3-(butylamino)-3-oxopropoxy]methyl]-2-(ethenylamino)-3-[3-(3-iodopropylamino)-3-oxopropoxy]propoxy]propanamide (PubChem CID 178050058) has the molecular formula C26H49IN4O6 and a molecular weight of 640.60 g/mol. Its IUPAC name is N-butyl-3-[2-[[3-(butylamino)-3-oxopropoxy]methyl]-2-(ethenylamino)-3-[3-(3-iodopropylamino)-3-oxopropoxy]propoxy]propanamide.
| Compound Name | N-butyl-3-[2-[[3-(butylamino)-3-oxopropoxy]methyl]-2-(ethenylamino)-3-[3-(3-iodopropylamino)-3-oxopropoxy]propoxy]propanamide |
|---|---|
| PubChem CID | 178050058 |
| Molecular Formula | C26H49IN4O6 |
| Molecular Weight | 640.60 g/mol |
| Exact Mass | 640.27 |
| IUPAC Name | N-butyl-3-[2-[[3-(butylamino)-3-oxopropoxy]methyl]-2-(ethenylamino)-3-[3-(3-iodopropylamino)-3-oxopropoxy]propoxy]propanamide |
| SMILES | C=CNC(COCCC(=O)NCCCC)(COCCC(=O)NCCCC)COCCC(=O)NCCCI |
| InChI | InChI=1S/C26H49IN4O6/c1-4-7-14-28-23(32)10-17-35-20-26(31-6-3,21-36-18-11-24(33)29-15-8-5-2)22-37-19-12-25(34)30-16-9-13-27/h6,31H,3-5,7-22H2,1-2H3,(H,28,32)(H,29,33)(H,30,34) |
| InChIKey | CTTBAKPBCWXLHH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 127.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.60 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|