C26H37N7O2 — CID 178052748
tert-butyl N-methylcarbamate;(E)-2-ethenyl-4-[4-[(2S)-2-methylazetidin-1-yl]spiro[6H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclobutane]-7-yl]-4-methyliminobut-2-enenitrile (PubChem CID 178052748) has the molecular formula C26H37N7O2 and a molecular weight of 479.63 g/mol. Its IUPAC name is tert-butyl N-methylcarbamate;(E)-2-ethenyl-4-[4-[(2S)-2-methylazetidin-1-yl]spiro[6H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclobutane]-7-yl]-4-methyliminobut-2-enenitrile.
| Compound Name | tert-butyl N-methylcarbamate;(E)-2-ethenyl-4-[4-[(2S)-2-methylazetidin-1-yl]spiro[6H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclobutane]-7-yl]-4-methyliminobut-2-enenitrile |
|---|---|
| PubChem CID | 178052748 |
| Molecular Formula | C26H37N7O2 |
| Molecular Weight | 479.63 g/mol |
| Exact Mass | 479.30 |
| IUPAC Name | tert-butyl N-methylcarbamate;(E)-2-ethenyl-4-[4-[(2S)-2-methylazetidin-1-yl]spiro[6H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclobutane]-7-yl]-4-methyliminobut-2-enenitrile |
| SMILES | C=C/C(C#N)=C\C(=N/C)N1CC2(CCC2)c2c1ncnc2N1CC[C@@H]1C.CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H24N6.C6H13NO2/c1-4-15(11-21)10-16(22-3)26-12-20(7-5-8-20)17-18(23-13-24-19(17)26)25-9-6-14(25)2;1-6(2,3)9-5(8)7-4/h4,10,13-14H,1,5-9,12H2,2-3H3;1-4H3,(H,7,8)/b15-10+,22-16+;/t14-;/m0./s1 |
| InChIKey | WOFZFYATNLPNRW-CXLIUVFNSA-N |
| XLogP | 4.12 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.63 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|