C26H33FN8O — CID 178052514
2-cyano-3-fluoro-N,2-dimethylpropanamide;(E)-2-ethenyl-4-[4-(2-methylazetidin-1-yl)spiro[6H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclobutane]-7-yl]-4-methyliminobut-2-enenitrile (PubChem CID 178052514) has the molecular formula C26H33FN8O and a molecular weight of 492.60 g/mol. Its IUPAC name is 2-cyano-3-fluoro-N,2-dimethylpropanamide;(E)-2-ethenyl-4-[4-(2-methylazetidin-1-yl)spiro[6H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclobutane]-7-yl]-4-methyliminobut-2-enenitrile.
| Compound Name | 2-cyano-3-fluoro-N,2-dimethylpropanamide;(E)-2-ethenyl-4-[4-(2-methylazetidin-1-yl)spiro[6H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclobutane]-7-yl]-4-methyliminobut-2-enenitrile |
|---|---|
| PubChem CID | 178052514 |
| Molecular Formula | C26H33FN8O |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.28 |
| IUPAC Name | 2-cyano-3-fluoro-N,2-dimethylpropanamide;(E)-2-ethenyl-4-[4-(2-methylazetidin-1-yl)spiro[6H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclobutane]-7-yl]-4-methyliminobut-2-enenitrile |
| SMILES | C=C/C(C#N)=C\C(=N/C)N1CC2(CCC2)c2c1ncnc2N1CCC1C.CNC(=O)C(C)(C#N)CF |
| InChI | InChI=1S/C20H24N6.C6H9FN2O/c1-4-15(11-21)10-16(22-3)26-12-20(7-5-8-20)17-18(23-13-24-19(17)26)25-9-6-14(25)2;1-6(3-7,4-8)5(10)9-2/h4,10,13-14H,1,5-9,12H2,2-3H3;3H2,1-2H3,(H,9,10)/b15-10+,22-16+; |
| InChIKey | MSHZUQLQWLFIOQ-VIFRYGLYSA-N |
| XLogP | 3.21 |
| TPSA | 121.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|