C27H35N7O — CID 178052483
6-azaspiro[3.4]octan-5-one;(E)-2-ethenyl-4-[4-[(2R)-2-methylazetidin-1-yl]spiro[6H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclobutane]-7-yl]-4-methyliminobut-2-enenitrile (PubChem CID 178052483) has the molecular formula C27H35N7O and a molecular weight of 473.63 g/mol. Its IUPAC name is 6-azaspiro[3.4]octan-5-one;(E)-2-ethenyl-4-[4-[(2R)-2-methylazetidin-1-yl]spiro[6H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclobutane]-7-yl]-4-methyliminobut-2-enenitrile.
| Compound Name | 6-azaspiro[3.4]octan-5-one;(E)-2-ethenyl-4-[4-[(2R)-2-methylazetidin-1-yl]spiro[6H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclobutane]-7-yl]-4-methyliminobut-2-enenitrile |
|---|---|
| PubChem CID | 178052483 |
| Molecular Formula | C27H35N7O |
| Molecular Weight | 473.63 g/mol |
| Exact Mass | 473.29 |
| IUPAC Name | 6-azaspiro[3.4]octan-5-one;(E)-2-ethenyl-4-[4-[(2R)-2-methylazetidin-1-yl]spiro[6H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclobutane]-7-yl]-4-methyliminobut-2-enenitrile |
| SMILES | C=C/C(C#N)=C\C(=N/C)N1CC2(CCC2)c2c1ncnc2N1CC[C@H]1C.O=C1NCCC12CCC2 |
| InChI | InChI=1S/C20H24N6.C7H11NO/c1-4-15(11-21)10-16(22-3)26-12-20(7-5-8-20)17-18(23-13-24-19(17)26)25-9-6-14(25)2;9-6-7(2-1-3-7)4-5-8-6/h4,10,13-14H,1,5-9,12H2,2-3H3;1-5H2,(H,8,9)/b15-10+,22-16+;/t14-;/m1./s1 |
| InChIKey | FJWOODQDVRLALG-KJHNXUNKSA-N |
| XLogP | 3.66 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.63 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|