C9H18N2 — CID 178053040
(1S)-2,2-dimethyl-1-[(Z)-prop-2-enylideneamino]butan-1-amine (PubChem CID 178053040) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is (1S)-2,2-dimethyl-1-[(Z)-prop-2-enylideneamino]butan-1-amine.
| Compound Name | (1S)-2,2-dimethyl-1-[(Z)-prop-2-enylideneamino]butan-1-amine |
|---|---|
| PubChem CID | 178053040 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | (1S)-2,2-dimethyl-1-[(Z)-prop-2-enylideneamino]butan-1-amine |
| SMILES | C=C/C=N\[C@H](N)C(C)(C)CC |
| InChI | InChI=1S/C9H18N2/c1-5-7-11-8(10)9(3,4)6-2/h5,7-8H,1,6,10H2,2-4H3/b11-7-/t8-/m0/s1 |
| InChIKey | BPMKZEOUQZQWIC-CLUBXZQOSA-N |
| XLogP | 1.96 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|