C20H23F2N3O4 — CID 178053062
1-[(2,4-difluorophenyl)methyl]-4-ethyltriazole;methyl 3-methyl-5-methylidene-4-oxooxane-3-carboxylate (PubChem CID 178053062) has the molecular formula C20H23F2N3O4 and a molecular weight of 407.42 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)methyl]-4-ethyltriazole;methyl 3-methyl-5-methylidene-4-oxooxane-3-carboxylate.
| Compound Name | 1-[(2,4-difluorophenyl)methyl]-4-ethyltriazole;methyl 3-methyl-5-methylidene-4-oxooxane-3-carboxylate |
|---|---|
| PubChem CID | 178053062 |
| Molecular Formula | C20H23F2N3O4 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 1-[(2,4-difluorophenyl)methyl]-4-ethyltriazole;methyl 3-methyl-5-methylidene-4-oxooxane-3-carboxylate |
| SMILES | C=C1COCC(C)(C(=O)OC)C1=O.CCc1cn(Cc2ccc(F)cc2F)nn1 |
| InChI | InChI=1S/C11H11F2N3.C9H12O4/c1-2-10-7-16(15-14-10)6-8-3-4-9(12)5-11(8)13;1-6-4-13-5-9(2,7(6)10)8(11)12-3/h3-5,7H,2,6H2,1H3;1,4-5H2,2-3H3 |
| InChIKey | ZNXUYXPDHYRRML-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|