C45H88N2O7 — CID 178056231
4-[4-[(1-amino-2-methylprop-1-enyl)amino]-2-methylbutanoyl]oxybutyl 2-butyloctanoate;4-oxopentyl 2-butyloctanoate;propane (PubChem CID 178056231) has the molecular formula C45H88N2O7 and a molecular weight of 769.21 g/mol. Its IUPAC name is 4-[4-[(1-amino-2-methylprop-1-enyl)amino]-2-methylbutanoyl]oxybutyl 2-butyloctanoate;4-oxopentyl 2-butyloctanoate;propane.
| Compound Name | 4-[4-[(1-amino-2-methylprop-1-enyl)amino]-2-methylbutanoyl]oxybutyl 2-butyloctanoate;4-oxopentyl 2-butyloctanoate;propane |
|---|---|
| PubChem CID | 178056231 |
| Molecular Formula | C45H88N2O7 |
| Molecular Weight | 769.21 g/mol |
| Exact Mass | 768.66 |
| IUPAC Name | 4-[4-[(1-amino-2-methylprop-1-enyl)amino]-2-methylbutanoyl]oxybutyl 2-butyloctanoate;4-oxopentyl 2-butyloctanoate;propane |
| SMILES | CCC.CCCCCCC(CCCC)C(=O)OCCCC(C)=O.CCCCCCC(CCCC)C(=O)OCCCCOC(=O)C(C)CCNC(N)=C(C)C |
| InChI | InChI=1S/C25H48N2O4.C17H32O3.C3H8/c1-6-8-10-11-15-22(14-9-7-2)25(29)31-19-13-12-18-30-24(28)21(5)16-17-27-23(26)20(3)4;1-4-6-8-9-13-16(12-7-5-2)17(19)20-14-10-11-15(3)18;1-3-2/h21-22,27H,6-19,26H2,1-5H3;16H,4-14H2,1-3H3;3H2,1-2H3 |
| InChIKey | ZXSXKFKEVWVXPG-UHFFFAOYSA-N |
| XLogP | 11.55 |
| TPSA | 134.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.21 |
| LogP ≤ 5 | 11.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|