C26H38F4N6O2 — CID 178058065
(Z)-2,5-diamino-4-[(E)-1-fluoroethyliminomethyl]-N-[2-methyl-1-[5-[(3Z,5E)-7-methyl-2-oxonona-3,5-dien-5-yl]-3-(trifluoromethyl)pyrazol-1-yl]propan-2-yl]pent-4-enamide (PubChem CID 178058065) has the molecular formula C26H38F4N6O2 and a molecular weight of 542.62 g/mol. Its IUPAC name is (Z)-2,5-diamino-4-[(E)-1-fluoroethyliminomethyl]-N-[2-methyl-1-[5-[(3Z,5E)-7-methyl-2-oxonona-3,5-dien-5-yl]-3-(trifluoromethyl)pyrazol-1-yl]propan-2-yl]pent-4-enamide.
| Compound Name | (Z)-2,5-diamino-4-[(E)-1-fluoroethyliminomethyl]-N-[2-methyl-1-[5-[(3Z,5E)-7-methyl-2-oxonona-3,5-dien-5-yl]-3-(trifluoromethyl)pyrazol-1-yl]propan-2-yl]pent-4-enamide |
|---|---|
| PubChem CID | 178058065 |
| Molecular Formula | C26H38F4N6O2 |
| Molecular Weight | 542.62 g/mol |
| Exact Mass | 542.30 |
| IUPAC Name | (Z)-2,5-diamino-4-[(E)-1-fluoroethyliminomethyl]-N-[2-methyl-1-[5-[(3Z,5E)-7-methyl-2-oxonona-3,5-dien-5-yl]-3-(trifluoromethyl)pyrazol-1-yl]propan-2-yl]pent-4-enamide |
| SMILES | CCC(C)/C=C(\C=C/C(C)=O)c1cc(C(F)(F)F)nn1CC(C)(C)NC(=O)C(N)CC(=C/N)/C=N/C(C)F |
| InChI | InChI=1S/C26H38F4N6O2/c1-7-16(2)10-20(9-8-17(3)37)22-12-23(26(28,29)30)35-36(22)15-25(5,6)34-24(38)21(32)11-19(13-31)14-33-18(4)27/h8-10,12-14,16,18,21H,7,11,15,31-32H2,1-6H3,(H,34,38)/b9-8-,19-13-,20-10+,33-14+ |
| InChIKey | BKWJUILHVGEWMC-UIOPNDDRSA-N |
| XLogP | 4.32 |
| TPSA | 128.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.62 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|