C22H19N5O2 — CID 178059188
1-[(2R)-but-3-yn-2-yl]-5-indazol-1-yl-6-methyl-3-(5-methyl-3-pyridinyl)pyrimidine-2,4-dione (PubChem CID 178059188) has the molecular formula C22H19N5O2 and a molecular weight of 385.43 g/mol. Its IUPAC name is 1-[(2R)-but-3-yn-2-yl]-5-indazol-1-yl-6-methyl-3-(5-methyl-3-pyridinyl)pyrimidine-2,4-dione.
| Compound Name | 1-[(2R)-but-3-yn-2-yl]-5-indazol-1-yl-6-methyl-3-(5-methyl-3-pyridinyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 178059188 |
| Molecular Formula | C22H19N5O2 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 1-[(2R)-but-3-yn-2-yl]-5-indazol-1-yl-6-methyl-3-(5-methyl-3-pyridinyl)pyrimidine-2,4-dione |
| SMILES | C#C[C@@H](C)n1c(C)c(-n2ncc3ccccc32)c(=O)n(-c2cncc(C)c2)c1=O |
| InChI | InChI=1S/C22H19N5O2/c1-5-15(3)25-16(4)20(27-19-9-7-6-8-17(19)12-24-27)21(28)26(22(25)29)18-10-14(2)11-23-13-18/h1,6-13,15H,2-4H3/t15-/m1/s1 |
| InChIKey | USMRSQXFDTZYLM-OAHLLOKOSA-N |
| XLogP | 2.54 |
| TPSA | 74.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|