C21H17F2N5O2 — CID 178059134
5-(5,6-difluoroindazol-2-yl)-6-methyl-3-(5-methyl-3-pyridinyl)-1-prop-2-enylpyrimidine-2,4-dione (PubChem CID 178059134) has the molecular formula C21H17F2N5O2 and a molecular weight of 409.40 g/mol. Its IUPAC name is 5-(5,6-difluoroindazol-2-yl)-6-methyl-3-(5-methyl-3-pyridinyl)-1-prop-2-enylpyrimidine-2,4-dione.
| Compound Name | 5-(5,6-difluoroindazol-2-yl)-6-methyl-3-(5-methyl-3-pyridinyl)-1-prop-2-enylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 178059134 |
| Molecular Formula | C21H17F2N5O2 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 5-(5,6-difluoroindazol-2-yl)-6-methyl-3-(5-methyl-3-pyridinyl)-1-prop-2-enylpyrimidine-2,4-dione |
| SMILES | C=CCn1c(C)c(-n2cc3cc(F)c(F)cc3n2)c(=O)n(-c2cncc(C)c2)c1=O |
| InChI | InChI=1S/C21H17F2N5O2/c1-4-5-26-13(3)19(27-11-14-7-16(22)17(23)8-18(14)25-27)20(29)28(21(26)30)15-6-12(2)9-24-10-15/h4,6-11H,1,5H2,2-3H3 |
| InChIKey | XGMXTAYXKRDECE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 74.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|