C17H18N4O2 — CID 46047459
7-ethyl-3-(4-methylphenyl)-1-prop-2-enylpurine-2,6-dione (PubChem CID 46047459) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is 7-ethyl-3-(4-methylphenyl)-1-prop-2-enylpurine-2,6-dione.
| Compound Name | 7-ethyl-3-(4-methylphenyl)-1-prop-2-enylpurine-2,6-dione |
|---|---|
| PubChem CID | 46047459 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 7-ethyl-3-(4-methylphenyl)-1-prop-2-enylpurine-2,6-dione |
| SMILES | C=CCn1c(=O)c2c(ncn2CC)n(-c2ccc(C)cc2)c1=O |
| InChI | InChI=1S/C17H18N4O2/c1-4-10-20-16(22)14-15(18-11-19(14)5-2)21(17(20)23)13-8-6-12(3)7-9-13/h4,6-9,11H,1,5,10H2,2-3H3 |
| InChIKey | BKDRJFZTFIXWLJ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|