C22H19N5O2 — CID 42863097
2-[[1-ethyl-3-(4-methylphenyl)-2,6-dioxopurin-7-yl]methyl]benzonitrile (PubChem CID 42863097) has the molecular formula C22H19N5O2 and a molecular weight of 385.43 g/mol. Its IUPAC name is 2-[[1-ethyl-3-(4-methylphenyl)-2,6-dioxopurin-7-yl]methyl]benzonitrile.
| Compound Name | 2-[[1-ethyl-3-(4-methylphenyl)-2,6-dioxopurin-7-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 42863097 |
| Molecular Formula | C22H19N5O2 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 2-[[1-ethyl-3-(4-methylphenyl)-2,6-dioxopurin-7-yl]methyl]benzonitrile |
| SMILES | CCn1c(=O)c2c(ncn2Cc2ccccc2C#N)n(-c2ccc(C)cc2)c1=O |
| InChI | InChI=1S/C22H19N5O2/c1-3-26-21(28)19-20(27(22(26)29)18-10-8-15(2)9-11-18)24-14-25(19)13-17-7-5-4-6-16(17)12-23/h4-11,14H,3,13H2,1-2H3 |
| InChIKey | BJKSZHXESKKDLV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 85.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |