About 2-[[3-(4-chlorophenyl)-2,6-dioxo-1-(2-phenylethyl)purin-7-yl]methyl]benzonitrile
2-[[3-(4-chlorophenyl)-2,6-dioxo-1-(2-phenylethyl)purin-7-yl]methyl]benzonitrile (PubChem CID 46062062) has the molecular formula C27H20ClN5O2
and a molecular weight of 481.94 g/mol. Its IUPAC name is 2-[[3-(4-chlorophenyl)-2,6-dioxo-1-(2-phenylethyl)purin-7-yl]methyl]benzonitrile.
Molecular Properties
| Compound Name | 2-[[3-(4-chlorophenyl)-2,6-dioxo-1-(2-phenylethyl)purin-7-yl]methyl]benzonitrile |
| PubChem CID | 46062062 |
| Molecular Formula | C27H20ClN5O2 |
| Molecular Weight | 481.94 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | 2-[[3-(4-chlorophenyl)-2,6-dioxo-1-(2-phenylethyl)purin-7-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1Cn1cnc2c1c(=O)n(CCc1ccccc1)c(=O)n2-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H20ClN5O2/c28-22-10-12-23(13-11-22)33-25-24(31(18-30-25)17-21-9-5-4-8-20(21)16-29)26(34)32(27(33)35)15-14-19-6-2-1-3-7-19/h1-13,18H,14-15,17H2 |
| InChIKey | WAYALLBDZZYERU-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 85.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 481.94 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[[3-(4-chlorophenyl)-2,6-dioxo-1-(2-phenylethyl)purin-7-yl]methyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3-(4-chlorophenyl)-2,6-dioxo-1-(2-phenylethyl)purin-7-yl]methyl]benzonitrile?
The IUPAC name of 2-[[3-(4-chlorophenyl)-2,6-dioxo-1-(2-phenylethyl)purin-7-yl]methyl]benzonitrile (CID 46062062) is 2-[[3-(4-chlorophenyl)-2,6-dioxo-1-(2-phenylethyl)purin-7-yl]methyl]benzonitrile.
What is the SMILES notation for 2-[[3-(4-chlorophenyl)-2,6-dioxo-1-(2-phenylethyl)purin-7-yl]methyl]benzonitrile?
The canonical SMILES for 2-[[3-(4-chlorophenyl)-2,6-dioxo-1-(2-phenylethyl)purin-7-yl]methyl]benzonitrile is N#Cc1ccccc1Cn1cnc2c1c(=O)n(CCc1ccccc1)c(=O)n2-c1ccc(Cl)cc1.
What is the InChIKey of 2-[[3-(4-chlorophenyl)-2,6-dioxo-1-(2-phenylethyl)purin-7-yl]methyl]benzonitrile?
The InChIKey is WAYALLBDZZYERU-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H20ClN5O2/c28-22-10-12-23(13-11-22)33-25-24(31(18-30-25)17-21-9-5-4-8-20(21)16-29)26(34)32(27(33)35)15-14-19-6-2-1-3-7-19/h1-13,18H,14-15,17H2.
What are the key properties of 2-[[3-(4-chlorophenyl)-2,6-dioxo-1-(2-phenylethyl)purin-7-yl]methyl]benzonitrile?
2-[[3-(4-chlorophenyl)-2,6-dioxo-1-(2-phenylethyl)purin-7-yl]methyl]benzonitrile has a molecular weight of 481.94 g/mol, XLogP of 4.16, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3-(4-chlorophenyl)-2,6-dioxo-1-(2-phenylethyl)purin-7-yl]methyl]benzonitrile is sourced from PubChem (CID 46062062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).