C19H16ClN5O2 — CID 42863128
3-(4-chlorophenyl)-1-ethyl-7-(pyridin-4-ylmethyl)purine-2,6-dione (PubChem CID 42863128) has the molecular formula C19H16ClN5O2 and a molecular weight of 381.82 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-ethyl-7-(pyridin-4-ylmethyl)purine-2,6-dione.
| Compound Name | 3-(4-chlorophenyl)-1-ethyl-7-(pyridin-4-ylmethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 42863128 |
| Molecular Formula | C19H16ClN5O2 |
| Molecular Weight | 381.82 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 3-(4-chlorophenyl)-1-ethyl-7-(pyridin-4-ylmethyl)purine-2,6-dione |
| SMILES | CCn1c(=O)c2c(ncn2Cc2ccncc2)n(-c2ccc(Cl)cc2)c1=O |
| InChI | InChI=1S/C19H16ClN5O2/c1-2-24-18(26)16-17(22-12-23(16)11-13-7-9-21-10-8-13)25(19(24)27)15-5-3-14(20)4-6-15/h3-10,12H,2,11H2,1H3 |
| InChIKey | LQLXCFVFODPWFI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 74.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.82 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |