About methyl 5-[[3-(4-chlorophenyl)-2,6-dioxo-1-(2-phenylethyl)purin-7-yl]methyl]furan-2-carboxylate
methyl 5-[[3-(4-chlorophenyl)-2,6-dioxo-1-(2-phenylethyl)purin-7-yl]methyl]furan-2-carboxylate (PubChem CID 46062061) has the molecular formula C26H21ClN4O5
and a molecular weight of 504.93 g/mol. Its IUPAC name is methyl 5-[[3-(4-chlorophenyl)-2,6-dioxo-1-(2-phenylethyl)purin-7-yl]methyl]furan-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[[3-(4-chlorophenyl)-2,6-dioxo-1-(2-phenylethyl)purin-7-yl]methyl]furan-2-carboxylate |
| PubChem CID | 46062061 |
| Molecular Formula | C26H21ClN4O5 |
| Molecular Weight | 504.93 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | methyl 5-[[3-(4-chlorophenyl)-2,6-dioxo-1-(2-phenylethyl)purin-7-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(Cn2cnc3c2c(=O)n(CCc2ccccc2)c(=O)n3-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C26H21ClN4O5/c1-35-25(33)21-12-11-20(36-21)15-29-16-28-23-22(29)24(32)30(14-13-17-5-3-2-4-6-17)26(34)31(23)19-9-7-18(27)8-10-19/h2-12,16H,13-15H2,1H3 |
| InChIKey | VDRXEBLUKLNFDQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 101.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 504.93 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze methyl 5-[[3-(4-chlorophenyl)-2,6-dioxo-1-(2-phenylethyl)purin-7-yl]methyl]furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[[3-(4-chlorophenyl)-2,6-dioxo-1-(2-phenylethyl)purin-7-yl]methyl]furan-2-carboxylate?
The IUPAC name of methyl 5-[[3-(4-chlorophenyl)-2,6-dioxo-1-(2-phenylethyl)purin-7-yl]methyl]furan-2-carboxylate (CID 46062061) is methyl 5-[[3-(4-chlorophenyl)-2,6-dioxo-1-(2-phenylethyl)purin-7-yl]methyl]furan-2-carboxylate.
What is the SMILES notation for methyl 5-[[3-(4-chlorophenyl)-2,6-dioxo-1-(2-phenylethyl)purin-7-yl]methyl]furan-2-carboxylate?
The canonical SMILES for methyl 5-[[3-(4-chlorophenyl)-2,6-dioxo-1-(2-phenylethyl)purin-7-yl]methyl]furan-2-carboxylate is COC(=O)c1ccc(Cn2cnc3c2c(=O)n(CCc2ccccc2)c(=O)n3-c2ccc(Cl)cc2)o1.
What is the InChIKey of methyl 5-[[3-(4-chlorophenyl)-2,6-dioxo-1-(2-phenylethyl)purin-7-yl]methyl]furan-2-carboxylate?
The InChIKey is VDRXEBLUKLNFDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H21ClN4O5/c1-35-25(33)21-12-11-20(36-21)15-29-16-28-23-22(29)24(32)30(14-13-17-5-3-2-4-6-17)26(34)31(23)19-9-7-18(27)8-10-19/h2-12,16H,13-15H2,1H3.
What are the key properties of methyl 5-[[3-(4-chlorophenyl)-2,6-dioxo-1-(2-phenylethyl)purin-7-yl]methyl]furan-2-carboxylate?
methyl 5-[[3-(4-chlorophenyl)-2,6-dioxo-1-(2-phenylethyl)purin-7-yl]methyl]furan-2-carboxylate has a molecular weight of 504.93 g/mol, XLogP of 3.67, 7 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[[3-(4-chlorophenyl)-2,6-dioxo-1-(2-phenylethyl)purin-7-yl]methyl]furan-2-carboxylate is sourced from PubChem (CID 46062061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).