About 1-ethynylindazole
1-ethynylindazole (PubChem CID 118207133) has the molecular formula C9H6N2
and a molecular weight of 142.16 g/mol. Its IUPAC name is 1-ethynylindazole.
Molecular Properties
| Compound Name | 1-ethynylindazole |
| PubChem CID | 118207133 |
| Molecular Formula | C9H6N2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.05 |
| IUPAC Name | 1-ethynylindazole |
| SMILES | C#Cn1ncc2ccccc21 |
| InChI | InChI=1S/C9H6N2/c1-2-11-9-6-4-3-5-8(9)7-10-11/h1,3-7H |
| InChIKey | WYXZSAPFBFDSDC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-ethynylindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethynylindazole?
The IUPAC name of 1-ethynylindazole (CID 118207133) is 1-ethynylindazole.
What is the SMILES notation for 1-ethynylindazole?
The canonical SMILES for 1-ethynylindazole is C#Cn1ncc2ccccc21.
What is the InChIKey of 1-ethynylindazole?
The InChIKey is WYXZSAPFBFDSDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2/c1-2-11-9-6-4-3-5-8(9)7-10-11/h1,3-7H.
What are the key properties of 1-ethynylindazole?
1-ethynylindazole has a molecular weight of 142.16 g/mol, XLogP of 1.48, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethynylindazole is sourced from PubChem (CID 118207133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).