C26H38N6O8 — CID 178062521
3-[2-[2-[2-[3-[3,5-bis(5-methyl-1,3,4-oxadiazol-2-yl)anilino]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]propanamide;ethane (PubChem CID 178062521) has the molecular formula C26H38N6O8 and a molecular weight of 562.62 g/mol. Its IUPAC name is 3-[2-[2-[2-[3-[3,5-bis(5-methyl-1,3,4-oxadiazol-2-yl)anilino]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]propanamide;ethane.
| Compound Name | 3-[2-[2-[2-[3-[3,5-bis(5-methyl-1,3,4-oxadiazol-2-yl)anilino]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]propanamide;ethane |
|---|---|
| PubChem CID | 178062521 |
| Molecular Formula | C26H38N6O8 |
| Molecular Weight | 562.62 g/mol |
| Exact Mass | 562.28 |
| IUPAC Name | 3-[2-[2-[2-[3-[3,5-bis(5-methyl-1,3,4-oxadiazol-2-yl)anilino]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]propanamide;ethane |
| SMILES | CC.Cc1nnc(-c2cc(NC(=O)CCOCCOCCOCCOCCC(N)=O)cc(-c3nnc(C)o3)c2)o1 |
| InChI | InChI=1S/C24H32N6O8.C2H6/c1-16-27-29-23(37-16)18-13-19(24-30-28-17(2)38-24)15-20(14-18)26-22(32)4-6-34-8-10-36-12-11-35-9-7-33-5-3-21(25)31;1-2/h13-15H,3-12H2,1-2H3,(H2,25,31)(H,26,32);1-2H3 |
| InChIKey | BPSNWSXNZFONAE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 186.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.62 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|