C26H40N6O8 — CID 177366161
ethanimidoyl 3-(5-methyl-1,3,4-oxadiazol-2-yl)-5-[3-[2-[2-[2-(3-oxobutoxy)ethoxy]ethoxy]ethoxy]propanoylamino]benzenecarboximidate;methanamine (PubChem CID 177366161) has the molecular formula C26H40N6O8 and a molecular weight of 564.64 g/mol. Its IUPAC name is ethanimidoyl 3-(5-methyl-1,3,4-oxadiazol-2-yl)-5-[3-[2-[2-[2-(3-oxobutoxy)ethoxy]ethoxy]ethoxy]propanoylamino]benzenecarboximidate;methanamine.
| Compound Name | ethanimidoyl 3-(5-methyl-1,3,4-oxadiazol-2-yl)-5-[3-[2-[2-[2-(3-oxobutoxy)ethoxy]ethoxy]ethoxy]propanoylamino]benzenecarboximidate;methanamine |
|---|---|
| PubChem CID | 177366161 |
| Molecular Formula | C26H40N6O8 |
| Molecular Weight | 564.64 g/mol |
| Exact Mass | 564.29 |
| IUPAC Name | ethanimidoyl 3-(5-methyl-1,3,4-oxadiazol-2-yl)-5-[3-[2-[2-[2-(3-oxobutoxy)ethoxy]ethoxy]ethoxy]propanoylamino]benzenecarboximidate;methanamine |
| SMILES | CN.[H]/N=C(\O/C(C)=N/[H])c1cc(NC(=O)CCOCCOCCOCCOCCC(C)=O)cc(-c2nnc(C)o2)c1 |
| InChI | InChI=1S/C25H35N5O8.CH5N/c1-17(31)4-6-33-8-10-35-12-13-36-11-9-34-7-5-23(32)28-22-15-20(24(27)37-18(2)26)14-21(16-22)25-30-29-19(3)38-25;1-2/h14-16,26-27H,4-13H2,1-3H3,(H,28,32);2H2,1H3/b26-18+,27-24-; |
| InChIKey | XUYHUPHJKNYBCU-BUDGGEFOSA-N |
| XLogP | 2.33 |
| TPSA | 204.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.64 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|