C33H32N2O6 — CID 178064575
butyl 4-[[3-[[3-(4-hydroxyphenyl)benzoyl]amino]-4-methoxyphenyl]carbamoyl]-2-methylbenzoate (PubChem CID 178064575) has the molecular formula C33H32N2O6 and a molecular weight of 552.63 g/mol. Its IUPAC name is butyl 4-[[3-[[3-(4-hydroxyphenyl)benzoyl]amino]-4-methoxyphenyl]carbamoyl]-2-methylbenzoate.
| Compound Name | butyl 4-[[3-[[3-(4-hydroxyphenyl)benzoyl]amino]-4-methoxyphenyl]carbamoyl]-2-methylbenzoate |
|---|---|
| PubChem CID | 178064575 |
| Molecular Formula | C33H32N2O6 |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | butyl 4-[[3-[[3-(4-hydroxyphenyl)benzoyl]amino]-4-methoxyphenyl]carbamoyl]-2-methylbenzoate |
| SMILES | CCCCOC(=O)c1ccc(C(=O)Nc2ccc(OC)c(NC(=O)c3cccc(-c4ccc(O)cc4)c3)c2)cc1C |
| InChI | InChI=1S/C33H32N2O6/c1-4-5-17-41-33(39)28-15-11-25(18-21(28)2)31(37)34-26-12-16-30(40-3)29(20-26)35-32(38)24-8-6-7-23(19-24)22-9-13-27(36)14-10-22/h6-16,18-20,36H,4-5,17H2,1-3H3,(H,34,37)(H,35,38) |
| InChIKey | FLFXCWHORJNSIR-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|