C23H32N4O2 — CID 178066213
6-[(2-amino-2,3-dihydro-1H-inden-5-yl)methyl]-1,11-dimethyl-3,6,9-triazatricyclo[7.3.1.13,11]tetradecane-4,8-dione (PubChem CID 178066213) has the molecular formula C23H32N4O2 and a molecular weight of 396.54 g/mol. Its IUPAC name is 6-[(2-amino-2,3-dihydro-1H-inden-5-yl)methyl]-1,11-dimethyl-3,6,9-triazatricyclo[7.3.1.13,11]tetradecane-4,8-dione.
| Compound Name | 6-[(2-amino-2,3-dihydro-1H-inden-5-yl)methyl]-1,11-dimethyl-3,6,9-triazatricyclo[7.3.1.13,11]tetradecane-4,8-dione |
|---|---|
| PubChem CID | 178066213 |
| Molecular Formula | C23H32N4O2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | 6-[(2-amino-2,3-dihydro-1H-inden-5-yl)methyl]-1,11-dimethyl-3,6,9-triazatricyclo[7.3.1.13,11]tetradecane-4,8-dione |
| SMILES | CC12CN3CC(C)(CN(C1)C(=O)CN(Cc1ccc4c(c1)CC(N)C4)CC3=O)C2 |
| InChI | InChI=1S/C23H32N4O2/c1-22-11-23(2)14-26(12-22)20(28)9-25(10-21(29)27(13-22)15-23)8-16-3-4-17-6-19(24)7-18(17)5-16/h3-5,19H,6-15,24H2,1-2H3 |
| InChIKey | LXVRMKZQNZRREL-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |