C22H32F2O3 — CID 178066806
2-[4-[4-(4-ethylcyclohexyl)cyclohexyl]-2,3-difluorophenoxy]ethane-1,1-diol (PubChem CID 178066806) has the molecular formula C22H32F2O3 and a molecular weight of 382.49 g/mol. Its IUPAC name is 2-[4-[4-(4-ethylcyclohexyl)cyclohexyl]-2,3-difluorophenoxy]ethane-1,1-diol.
| Compound Name | 2-[4-[4-(4-ethylcyclohexyl)cyclohexyl]-2,3-difluorophenoxy]ethane-1,1-diol |
|---|---|
| PubChem CID | 178066806 |
| Molecular Formula | C22H32F2O3 |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | 2-[4-[4-(4-ethylcyclohexyl)cyclohexyl]-2,3-difluorophenoxy]ethane-1,1-diol |
| SMILES | CCC1CCC(C2CCC(c3ccc(OCC(O)O)c(F)c3F)CC2)CC1 |
| InChI | InChI=1S/C22H32F2O3/c1-2-14-3-5-15(6-4-14)16-7-9-17(10-8-16)18-11-12-19(22(24)21(18)23)27-13-20(25)26/h11-12,14-17,20,25-26H,2-10,13H2,1H3 |
| InChIKey | WTHLNLYWNIKBHJ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|