C26H21Cl2F4N3O5 — CID 178068323
(1-cyanocyclopropyl) N-[4-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylbenzoyl]-N-(1-methoxyethyl)carbamate (PubChem CID 178068323) has the molecular formula C26H21Cl2F4N3O5 and a molecular weight of 602.37 g/mol. Its IUPAC name is (1-cyanocyclopropyl) N-[4-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylbenzoyl]-N-(1-methoxyethyl)carbamate.
| Compound Name | (1-cyanocyclopropyl) N-[4-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylbenzoyl]-N-(1-methoxyethyl)carbamate |
|---|---|
| PubChem CID | 178068323 |
| Molecular Formula | C26H21Cl2F4N3O5 |
| Molecular Weight | 602.37 g/mol |
| Exact Mass | 601.08 |
| IUPAC Name | (1-cyanocyclopropyl) N-[4-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylbenzoyl]-N-(1-methoxyethyl)carbamate |
| SMILES | COC(C)N(C(=O)OC1(C#N)CC1)C(=O)c1ccc(C2=NOC(c3cc(Cl)c(F)c(Cl)c3)(C(F)(F)F)C2)cc1C |
| InChI | InChI=1S/C26H21Cl2F4N3O5/c1-13-8-15(4-5-17(13)22(36)35(14(2)38-3)23(37)39-24(12-33)6-7-24)20-11-25(40-34-20,26(30,31)32)16-9-18(27)21(29)19(28)10-16/h4-5,8-10,14H,6-7,11H2,1-3H3 |
| InChIKey | FWCYUKGIPJLEHY-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 101.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.37 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|