C17H16FNO4 — CID 178068620
3-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-5-fluoro-2-hydroxybenzamide (PubChem CID 178068620) has the molecular formula C17H16FNO4 and a molecular weight of 317.32 g/mol. Its IUPAC name is 3-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-5-fluoro-2-hydroxybenzamide.
| Compound Name | 3-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-5-fluoro-2-hydroxybenzamide |
|---|---|
| PubChem CID | 178068620 |
| Molecular Formula | C17H16FNO4 |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 3-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-5-fluoro-2-hydroxybenzamide |
| SMILES | COc1ccc(/C=C/c2cc(F)cc(C(N)=O)c2O)cc1OC |
| InChI | InChI=1S/C17H16FNO4/c1-22-14-6-4-10(7-15(14)23-2)3-5-11-8-12(18)9-13(16(11)20)17(19)21/h3-9,20H,1-2H3,(H2,19,21)/b5-3+ |
| InChIKey | FDPCMYIDKUBVJF-HWKANZROSA-N |
| XLogP | 2.82 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|