C16H13FN2O — CID 178070297
5'-amino-6'-fluoro-1'-phenylspiro[cyclopropane-1,3'-indole]-2'-one (PubChem CID 178070297) has the molecular formula C16H13FN2O and a molecular weight of 268.29 g/mol. Its IUPAC name is 5'-amino-6'-fluoro-1'-phenylspiro[cyclopropane-1,3'-indole]-2'-one.
| Compound Name | 5'-amino-6'-fluoro-1'-phenylspiro[cyclopropane-1,3'-indole]-2'-one |
|---|---|
| PubChem CID | 178070297 |
| Molecular Formula | C16H13FN2O |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 5'-amino-6'-fluoro-1'-phenylspiro[cyclopropane-1,3'-indole]-2'-one |
| SMILES | Nc1cc2c(cc1F)N(c1ccccc1)C(=O)C21CC1 |
| InChI | InChI=1S/C16H13FN2O/c17-12-9-14-11(8-13(12)18)16(6-7-16)15(20)19(14)10-4-2-1-3-5-10/h1-5,8-9H,6-7,18H2 |
| InChIKey | ZECGFVYINZRXJF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|