About 5-fluoro-1'-methyl-1-pyridin-3-ylspiro[indole-3,4'-piperidine]-2-one;hydrochloride
5-fluoro-1'-methyl-1-pyridin-3-ylspiro[indole-3,4'-piperidine]-2-one;hydrochloride (PubChem CID 118741579) has the molecular formula C18H19ClFN3O
and a molecular weight of 347.82 g/mol. Its IUPAC name is 5-fluoro-1'-methyl-1-pyridin-3-ylspiro[indole-3,4'-piperidine]-2-one;hydrochloride.
Molecular Properties
| Compound Name | 5-fluoro-1'-methyl-1-pyridin-3-ylspiro[indole-3,4'-piperidine]-2-one;hydrochloride |
| PubChem CID | 118741579 |
| Molecular Formula | C18H19ClFN3O |
| Molecular Weight | 347.82 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 5-fluoro-1'-methyl-1-pyridin-3-ylspiro[indole-3,4'-piperidine]-2-one;hydrochloride |
| SMILES | CN1CCC2(CC1)C(=O)N(c1cccnc1)c1ccc(F)cc12.Cl |
| InChI | InChI=1S/C18H18FN3O.ClH/c1-21-9-6-18(7-10-21)15-11-13(19)4-5-16(15)22(17(18)23)14-3-2-8-20-12-14;/h2-5,8,11-12H,6-7,9-10H2,1H3;1H |
| InChIKey | ZSIILPBUZMXEDU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.82 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-fluoro-1'-methyl-1-pyridin-3-ylspiro[indole-3,4'-piperidine]-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-1'-methyl-1-pyridin-3-ylspiro[indole-3,4'-piperidine]-2-one;hydrochloride?
The IUPAC name of 5-fluoro-1'-methyl-1-pyridin-3-ylspiro[indole-3,4'-piperidine]-2-one;hydrochloride (CID 118741579) is 5-fluoro-1'-methyl-1-pyridin-3-ylspiro[indole-3,4'-piperidine]-2-one;hydrochloride.
What is the SMILES notation for 5-fluoro-1'-methyl-1-pyridin-3-ylspiro[indole-3,4'-piperidine]-2-one;hydrochloride?
The canonical SMILES for 5-fluoro-1'-methyl-1-pyridin-3-ylspiro[indole-3,4'-piperidine]-2-one;hydrochloride is CN1CCC2(CC1)C(=O)N(c1cccnc1)c1ccc(F)cc12.Cl.
What is the InChIKey of 5-fluoro-1'-methyl-1-pyridin-3-ylspiro[indole-3,4'-piperidine]-2-one;hydrochloride?
The InChIKey is ZSIILPBUZMXEDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18FN3O.ClH/c1-21-9-6-18(7-10-21)15-11-13(19)4-5-16(15)22(17(18)23)14-3-2-8-20-12-14;/h2-5,8,11-12H,6-7,9-10H2,1H3;1H.
What are the key properties of 5-fluoro-1'-methyl-1-pyridin-3-ylspiro[indole-3,4'-piperidine]-2-one;hydrochloride?
5-fluoro-1'-methyl-1-pyridin-3-ylspiro[indole-3,4'-piperidine]-2-one;hydrochloride has a molecular weight of 347.82 g/mol, XLogP of 3.28, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-1'-methyl-1-pyridin-3-ylspiro[indole-3,4'-piperidine]-2-one;hydrochloride is sourced from PubChem (CID 118741579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).