C26H23ClF2N2O — CID 178070450
N-[4,4-bis(4-fluorophenyl)butyl]-2-(4-chloro-1H-indol-3-yl)acetamide (PubChem CID 178070450) has the molecular formula C26H23ClF2N2O and a molecular weight of 452.93 g/mol. Its IUPAC name is N-[4,4-bis(4-fluorophenyl)butyl]-2-(4-chloro-1H-indol-3-yl)acetamide.
| Compound Name | N-[4,4-bis(4-fluorophenyl)butyl]-2-(4-chloro-1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 178070450 |
| Molecular Formula | C26H23ClF2N2O |
| Molecular Weight | 452.93 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | N-[4,4-bis(4-fluorophenyl)butyl]-2-(4-chloro-1H-indol-3-yl)acetamide |
| SMILES | O=C(Cc1c[nH]c2cccc(Cl)c12)NCCCC(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H23ClF2N2O/c27-23-4-1-5-24-26(23)19(16-31-24)15-25(32)30-14-2-3-22(17-6-10-20(28)11-7-17)18-8-12-21(29)13-9-18/h1,4-13,16,22,31H,2-3,14-15H2,(H,30,32) |
| InChIKey | XXRVZSAFVJTTLP-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.93 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|