C22H25N3OS — CID 178078467
2-(1-benzothiophen-3-yl)-N-(2-phenylethyl)-2-piperazin-1-ylacetamide (PubChem CID 178078467) has the molecular formula C22H25N3OS and a molecular weight of 379.53 g/mol. Its IUPAC name is 2-(1-benzothiophen-3-yl)-N-(2-phenylethyl)-2-piperazin-1-ylacetamide.
| Compound Name | 2-(1-benzothiophen-3-yl)-N-(2-phenylethyl)-2-piperazin-1-ylacetamide |
|---|---|
| PubChem CID | 178078467 |
| Molecular Formula | C22H25N3OS |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 2-(1-benzothiophen-3-yl)-N-(2-phenylethyl)-2-piperazin-1-ylacetamide |
| SMILES | O=C(NCCc1ccccc1)C(c1csc2ccccc12)N1CCNCC1 |
| InChI | InChI=1S/C22H25N3OS/c26-22(24-11-10-17-6-2-1-3-7-17)21(25-14-12-23-13-15-25)19-16-27-20-9-5-4-8-18(19)20/h1-9,16,21,23H,10-15H2,(H,24,26) |
| InChIKey | BJWGDTVFIPCQOM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |