C26H30F2N4OS — CID 178080261
4-ethyl-5-[4-[2-(1-ethylidene-1,4-thiazinane-4-carbonyl)-3,3-difluoro-2-methylcyclopropyl]anilino]-2-methylpyridine-3-carbonitrile (PubChem CID 178080261) has the molecular formula C26H30F2N4OS and a molecular weight of 484.62 g/mol. Its IUPAC name is 4-ethyl-5-[4-[2-(1-ethylidene-1,4-thiazinane-4-carbonyl)-3,3-difluoro-2-methylcyclopropyl]anilino]-2-methylpyridine-3-carbonitrile.
| Compound Name | 4-ethyl-5-[4-[2-(1-ethylidene-1,4-thiazinane-4-carbonyl)-3,3-difluoro-2-methylcyclopropyl]anilino]-2-methylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 178080261 |
| Molecular Formula | C26H30F2N4OS |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | 4-ethyl-5-[4-[2-(1-ethylidene-1,4-thiazinane-4-carbonyl)-3,3-difluoro-2-methylcyclopropyl]anilino]-2-methylpyridine-3-carbonitrile |
| SMILES | CC=S1CCN(C(=O)C2(C)C(c3ccc(Nc4cnc(C)c(C#N)c4CC)cc3)C2(F)F)CC1 |
| InChI | InChI=1S/C26H30F2N4OS/c1-5-20-21(15-29)17(3)30-16-22(20)31-19-9-7-18(8-10-19)23-25(4,26(23,27)28)24(33)32-11-13-34(6-2)14-12-32/h6-10,16,23,31H,5,11-14H2,1-4H3 |
| InChIKey | KYRFKXHUAYQEDB-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|