C26H31F2N7O2S — CID 178081255
6-[[(Z)-1-amino-3-(methylamino)prop-2-enylidene]amino]-N-[1-(3-cyclopropyl-1-hydrazinylprop-2-ynyl)sulfanylethyl]-4-[5-(difluoromethyl)-2-methoxyphenyl]pyridine-3-carboxamide (PubChem CID 178081255) has the molecular formula C26H31F2N7O2S and a molecular weight of 543.64 g/mol. Its IUPAC name is 6-[[(Z)-1-amino-3-(methylamino)prop-2-enylidene]amino]-N-[1-(3-cyclopropyl-1-hydrazinylprop-2-ynyl)sulfanylethyl]-4-[5-(difluoromethyl)-2-methoxyphenyl]pyridine-3-carboxamide.
| Compound Name | 6-[[(Z)-1-amino-3-(methylamino)prop-2-enylidene]amino]-N-[1-(3-cyclopropyl-1-hydrazinylprop-2-ynyl)sulfanylethyl]-4-[5-(difluoromethyl)-2-methoxyphenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 178081255 |
| Molecular Formula | C26H31F2N7O2S |
| Molecular Weight | 543.64 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | 6-[[(Z)-1-amino-3-(methylamino)prop-2-enylidene]amino]-N-[1-(3-cyclopropyl-1-hydrazinylprop-2-ynyl)sulfanylethyl]-4-[5-(difluoromethyl)-2-methoxyphenyl]pyridine-3-carboxamide |
| SMILES | CN/C=C\C(N)=N\c1cc(-c2cc(C(F)F)ccc2OC)c(C(=O)NC(C)SC(C#CC2CC2)NN)cn1 |
| InChI | InChI=1S/C26H31F2N7O2S/c1-15(38-24(35-30)9-6-16-4-5-16)33-26(36)20-14-32-23(34-22(29)10-11-31-2)13-18(20)19-12-17(25(27)28)7-8-21(19)37-3/h7-8,10-16,24-25,31,35H,4-5,30H2,1-3H3,(H,33,36)(H2,29,32,34)/b11-10- |
| InChIKey | ISSYDZHTXPQUCN-KHPPLWFESA-N |
| XLogP | 3.43 |
| TPSA | 139.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.64 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|