C18H27NO5 — CID 178083581
4-[4-(hydroxymethyl)-2-methoxyphenoxy]-N-(2-methyl-5-oxopentan-2-yl)butanamide (PubChem CID 178083581) has the molecular formula C18H27NO5 and a molecular weight of 337.42 g/mol. Its IUPAC name is 4-[4-(hydroxymethyl)-2-methoxyphenoxy]-N-(2-methyl-5-oxopentan-2-yl)butanamide.
| Compound Name | 4-[4-(hydroxymethyl)-2-methoxyphenoxy]-N-(2-methyl-5-oxopentan-2-yl)butanamide |
|---|---|
| PubChem CID | 178083581 |
| Molecular Formula | C18H27NO5 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 4-[4-(hydroxymethyl)-2-methoxyphenoxy]-N-(2-methyl-5-oxopentan-2-yl)butanamide |
| SMILES | COc1cc(CO)ccc1OCCCC(=O)NC(C)(C)CCC=O |
| InChI | InChI=1S/C18H27NO5/c1-18(2,9-5-10-20)19-17(22)6-4-11-24-15-8-7-14(13-21)12-16(15)23-3/h7-8,10,12,21H,4-6,9,11,13H2,1-3H3,(H,19,22) |
| InChIKey | VTPYTSMMNUKHMI-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|