C49H64N10O6S — CID 178083698
CID 178083698 (PubChem CID 178083698) has the molecular formula C49H64N10O6S and a molecular weight of 921.18 g/mol.
| Compound Name | CID 178083698 |
|---|---|
| PubChem CID | 178083698 |
| Molecular Formula | C49H64N10O6S |
| Molecular Weight | 921.18 g/mol |
| Exact Mass | 920.47 |
| IUPAC Name | — |
| SMILES | Cc1cc(Nc2cc(NCCCCCCCC(=O)NC(C(=O)N3C[C@H](O)CC3C(=O)NCc3ccc(-c4scnc4C)cc3)C(C)(C)C)ncn2)c(=O)n2c1C(=O)NC21CCC2(CC2)CC1 |
| InChI | InChI=1S/C49H64N10O6S/c1-30-23-35(45(64)59-40(30)44(63)57-49(59)20-18-48(16-17-48)19-21-49)55-38-25-37(52-28-53-38)50-22-10-8-6-7-9-11-39(61)56-42(47(3,4)5)46(65)58-27-34(60)24-36(58)43(62)51-26-32-12-14-33(15-13-32)41-31(2)54-29-66-41/h12-15,23,25,28-29,34,36,42,60H,6-11,16-22,24,26-27H2,1-5H3,(H,51,62)(H,56,61)(H,57,63)(H2,50,52,53,55)/t34-,36?,42?/m1/s1 |
| InChIKey | QNLIKRMLETUQHJ-WJMVBBFVSA-N |
| XLogP | 6.43 |
| TPSA | 212.57 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 66 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 921.18 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|